C11H19Cl2MgNOS — CID 172688386
magnesium;2-octyl-1,2-thiazol-3-one;dichloride (PubChem CID 172688386) has the molecular formula C11H19Cl2MgNOS and a molecular weight of 308.56 g/mol. Its IUPAC name is magnesium;2-octyl-1,2-thiazol-3-one;dichloride.
| Compound Name | magnesium;2-octyl-1,2-thiazol-3-one;dichloride |
|---|---|
| PubChem CID | 172688386 |
| Molecular Formula | C11H19Cl2MgNOS |
| Molecular Weight | 308.56 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | magnesium;2-octyl-1,2-thiazol-3-one;dichloride |
| SMILES | CCCCCCCCn1sccc1=O.[Cl-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C11H19NOS.2ClH.Mg/c1-2-3-4-5-6-7-9-12-11(13)8-10-14-12;;;/h8,10H,2-7,9H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | BINPDXHJKIJVFY-UHFFFAOYSA-L |
| XLogP | -3.10 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.56 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|