C13H12ClFN2O2S — CID 129480269
(4S)-N-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 129480269) has the molecular formula C13H12ClFN2O2S and a molecular weight of 314.77 g/mol. Its IUPAC name is (4S)-N-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 129480269 |
| Molecular Formula | C13H12ClFN2O2S |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | (4S)-N-[(1R,2S)-2-(4-chloro-3-fluorophenyl)cyclopropyl]-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1N[C@@H](C(=O)N[C@@H]2C[C@H]2c2ccc(Cl)c(F)c2)CS1 |
| InChI | InChI=1S/C13H12ClFN2O2S/c14-8-2-1-6(3-9(8)15)7-4-10(7)16-12(18)11-5-20-13(19)17-11/h1-3,7,10-11H,4-5H2,(H,16,18)(H,17,19)/t7-,10+,11+/m0/s1 |
| InChIKey | NAVUHZMTVPGWTB-WHGOUJPWSA-N |
| XLogP | 2.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|