C9H8N4O — CID 13012268
4-nitroso-5-phenyl-1H-imidazol-2-amine (PubChem CID 13012268) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 4-nitroso-5-phenyl-1H-imidazol-2-amine.
| Compound Name | 4-nitroso-5-phenyl-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 13012268 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 4-nitroso-5-phenyl-1H-imidazol-2-amine |
| SMILES | Nc1nc(N=O)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C9H8N4O/c10-9-11-7(8(12-9)13-14)6-4-2-1-3-5-6/h1-5H,(H3,10,11,12) |
| InChIKey | PWKMKRNLVLDMCJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |