C13H23NO — CID 130224379
propan-2-yl (2Z,4Z)-5,7-dimethylocta-2,4-dienimidate (PubChem CID 130224379) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is propan-2-yl (2Z,4Z)-5,7-dimethylocta-2,4-dienimidate.
| Compound Name | propan-2-yl (2Z,4Z)-5,7-dimethylocta-2,4-dienimidate |
|---|---|
| PubChem CID | 130224379 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | propan-2-yl (2Z,4Z)-5,7-dimethylocta-2,4-dienimidate |
| SMILES | [H]/N=C(\C=C/C=C(/C)CC(C)C)OC(C)C |
| InChI | InChI=1S/C13H23NO/c1-10(2)9-12(5)7-6-8-13(14)15-11(3)4/h6-8,10-11,14H,9H2,1-5H3/b8-6-,12-7-,14-13+ |
| InChIKey | TZDGAEGGQJXWDD-BWIAKPBESA-N |
| XLogP | 3.94 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|