C19H31N7O5S — CID 130232764
[4-[(2S)-2-amino-3-(aminomethylamino)-3-oxopropyl]phenyl] N-[(4S)-4-amino-5-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentyl]carbamate (PubChem CID 130232764) has the molecular formula C19H31N7O5S and a molecular weight of 469.57 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-(aminomethylamino)-3-oxopropyl]phenyl] N-[(4S)-4-amino-5-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentyl]carbamate.
| Compound Name | [4-[(2S)-2-amino-3-(aminomethylamino)-3-oxopropyl]phenyl] N-[(4S)-4-amino-5-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 130232764 |
| Molecular Formula | C19H31N7O5S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | [4-[(2S)-2-amino-3-(aminomethylamino)-3-oxopropyl]phenyl] N-[(4S)-4-amino-5-[[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentyl]carbamate |
| SMILES | NCNC(=O)[C@@H](N)Cc1ccc(OC(=O)NCCC[C@H](N)C(=O)N[C@@H](CS)C(N)=O)cc1 |
| InChI | InChI=1S/C19H31N7O5S/c20-10-25-17(28)14(22)8-11-3-5-12(6-4-11)31-19(30)24-7-1-2-13(21)18(29)26-15(9-32)16(23)27/h3-6,13-15,32H,1-2,7-10,20-22H2,(H2,23,27)(H,24,30)(H,25,28)(H,26,29)/t13-,14-,15-/m0/s1 |
| InChIKey | LLHUADPRYRXWFS-KKUMJFAQSA-N |
| XLogP | -2.32 |
| TPSA | 217.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|