C30H47N13O6 — CID 130260821
N-[[4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-4-oxopentanamide (PubChem CID 130260821) has the molecular formula C30H47N13O6 and a molecular weight of 685.79 g/mol. Its IUPAC name is N-[[4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-4-oxopentanamide.
| Compound Name | N-[[4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 130260821 |
| Molecular Formula | C30H47N13O6 |
| Molecular Weight | 685.79 g/mol |
| Exact Mass | 685.38 |
| IUPAC Name | N-[[4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-4-oxopentanamide |
| SMILES | CC(=O)CCC(=O)NCc1ccc(-c2cccc(OCCN=C(N)N)c2OCCN=C(N)N)c(OCCN=C(N)N)c1OCCN=C(N)N |
| InChI | InChI=1S/C30H47N13O6/c1-18(44)5-8-23(45)43-17-19-6-7-21(26(49-16-12-42-30(37)38)24(19)47-14-10-40-28(33)34)20-3-2-4-22(46-13-9-39-27(31)32)25(20)48-15-11-41-29(35)36/h2-4,6-7H,5,8-17H2,1H3,(H,43,45)(H4,31,32,39)(H4,33,34,40)(H4,35,36,41)(H4,37,38,42) |
| InChIKey | YOEHXKPVEXLKJD-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 340.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.79 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|