C33H48N14O5S2 — CID 56833501
N-[[4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 56833501) has the molecular formula C33H48N14O5S2 and a molecular weight of 784.97 g/mol. Its IUPAC name is N-[[4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-[[4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 56833501 |
| Molecular Formula | C33H48N14O5S2 |
| Molecular Weight | 784.97 g/mol |
| Exact Mass | 784.34 |
| IUPAC Name | N-[[4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | NC(N)=NCCOc1cccc(-c2ccc(CNC(=O)CCSSc3ccccn3)c(OCCN=C(N)N)c2OCCN=C(N)N)c1OCCN=C(N)N |
| InChI | InChI=1S/C33H48N14O5S2/c34-30(35)43-11-15-49-24-5-3-4-22(28(24)51-17-13-45-32(38)39)23-8-7-21(20-47-25(48)9-19-53-54-26-6-1-2-10-42-26)27(50-16-12-44-31(36)37)29(23)52-18-14-46-33(40)41/h1-8,10H,9,11-20H2,(H,47,48)(H4,34,35,43)(H4,36,37,44)(H4,38,39,45)(H4,40,41,46) |
| InChIKey | OUPXCCJBCSBFLZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 336.51 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.97 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|