C30H41N11O4S2 — CID 25212100
N-[[3-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-4-[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 25212100) has the molecular formula C30H41N11O4S2 and a molecular weight of 683.86 g/mol. Its IUPAC name is N-[[3-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-4-[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-[[3-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-4-[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 25212100 |
| Molecular Formula | C30H41N11O4S2 |
| Molecular Weight | 683.86 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | N-[[3-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-4-[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | NC(N)=NCCOc1ccc(CNC(=O)CCSSc2ccccn2)cc1-c1cccc(OCCN=C(N)N)c1OCCN=C(N)N |
| InChI | InChI=1S/C30H41N11O4S2/c31-28(32)38-11-14-43-23-8-7-20(19-41-25(42)9-17-46-47-26-6-1-2-10-37-26)18-22(23)21-4-3-5-24(44-15-12-39-29(33)34)27(21)45-16-13-40-30(35)36/h1-8,10,18H,9,11-17,19H2,(H,41,42)(H4,31,32,38)(H4,33,34,39)(H4,35,36,40) |
| InChIKey | HSTSASRATAEUNF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 262.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.86 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|