C28H45N13O5S — CID 89035859
N-[[3-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-4,5-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-sulfanylpropanamide (PubChem CID 89035859) has the molecular formula C28H45N13O5S and a molecular weight of 675.82 g/mol. Its IUPAC name is N-[[3-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-4,5-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-sulfanylpropanamide.
| Compound Name | N-[[3-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-4,5-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 89035859 |
| Molecular Formula | C28H45N13O5S |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.34 |
| IUPAC Name | N-[[3-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-4,5-bis[2-(diaminomethylideneamino)ethoxy]phenyl]methyl]-3-sulfanylpropanamide |
| SMILES | NC(N)=NCCOc1cccc(-c2cc(CNC(=O)CCS)cc(OCCN=C(N)N)c2OCCN=C(N)N)c1OCCN=C(N)N |
| InChI | InChI=1S/C28H45N13O5S/c29-25(30)37-5-9-43-20-3-1-2-18(23(20)45-11-7-39-27(33)34)19-14-17(16-41-22(42)4-13-47)15-21(44-10-6-38-26(31)32)24(19)46-12-8-40-28(35)36/h1-3,14-15,47H,4-13,16H2,(H,41,42)(H4,29,30,37)(H4,31,32,38)(H4,33,34,39)(H4,35,36,40) |
| InChIKey | UIDCAJPASZUFLP-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 323.62 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|