C16H28O4 — CID 130279184
(1S,2R,5S,6R,11S,14R)-2,6,7,11-tetramethyl-8,10,12,13-tetraoxatricyclo[9.3.2.05,14]hexadecane (PubChem CID 130279184) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (1S,2R,5S,6R,11S,14R)-2,6,7,11-tetramethyl-8,10,12,13-tetraoxatricyclo[9.3.2.05,14]hexadecane.
| Compound Name | (1S,2R,5S,6R,11S,14R)-2,6,7,11-tetramethyl-8,10,12,13-tetraoxatricyclo[9.3.2.05,14]hexadecane |
|---|---|
| PubChem CID | 130279184 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (1S,2R,5S,6R,11S,14R)-2,6,7,11-tetramethyl-8,10,12,13-tetraoxatricyclo[9.3.2.05,14]hexadecane |
| SMILES | CC1OCO[C@]2(C)CC[C@@H]3[C@@H](OO2)[C@@H](CC[C@H]3C)[C@H]1C |
| InChI | InChI=1S/C16H28O4/c1-10-5-6-14-11(2)12(3)17-9-18-16(4)8-7-13(10)15(14)19-20-16/h10-15H,5-9H2,1-4H3/t10-,11+,12?,13+,14+,15-,16+/m1/s1 |
| InChIKey | ZKFNFGRHLMQIEN-QXNOGGNTSA-N |
| XLogP | 3.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|