C31H34O3 — CID 130304914
[(E)-3-[4-[2-ethyl-4-(4-ethylphenyl)-5-methylphenyl]phenoxy]but-2-en-2-yl] 2-methylprop-2-enoate (PubChem CID 130304914) has the molecular formula C31H34O3 and a molecular weight of 454.61 g/mol. Its IUPAC name is [(E)-3-[4-[2-ethyl-4-(4-ethylphenyl)-5-methylphenyl]phenoxy]but-2-en-2-yl] 2-methylprop-2-enoate.
| Compound Name | [(E)-3-[4-[2-ethyl-4-(4-ethylphenyl)-5-methylphenyl]phenoxy]but-2-en-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130304914 |
| Molecular Formula | C31H34O3 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [(E)-3-[4-[2-ethyl-4-(4-ethylphenyl)-5-methylphenyl]phenoxy]but-2-en-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O/C(C)=C(\C)Oc1ccc(-c2cc(C)c(-c3ccc(CC)cc3)cc2CC)cc1 |
| InChI | InChI=1S/C31H34O3/c1-8-24-10-12-26(13-11-24)29-19-25(9-2)30(18-21(29)5)27-14-16-28(17-15-27)33-22(6)23(7)34-31(32)20(3)4/h10-19H,3,8-9H2,1-2,4-7H3/b23-22+ |
| InChIKey | YMCYKUSWBXUOMN-GHVJWSGMSA-N |
| XLogP | 8.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|