C20H20ClF3N2O2S — CID 130336353
4-chloro-3-[2-[3-[2-(sulfanylamino)ethyl]oxetan-3-yl]ethyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130336353) has the molecular formula C20H20ClF3N2O2S and a molecular weight of 444.91 g/mol. Its IUPAC name is 4-chloro-3-[2-[3-[2-(sulfanylamino)ethyl]oxetan-3-yl]ethyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[2-[3-[2-(sulfanylamino)ethyl]oxetan-3-yl]ethyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130336353 |
| Molecular Formula | C20H20ClF3N2O2S |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 4-chloro-3-[2-[3-[2-(sulfanylamino)ethyl]oxetan-3-yl]ethyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(CCC2(CCNS)COC2)c1 |
| InChI | InChI=1S/C20H20ClF3N2O2S/c21-15-2-1-13(19(27)26-14-8-16(22)18(24)17(23)9-14)7-12(15)3-4-20(5-6-25-29)10-28-11-20/h1-2,7-9,25,29H,3-6,10-11H2,(H,26,27) |
| InChIKey | URTHRYJUUAUVIK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|