C18H19ClF3N3O2S — CID 145187882
4-chloro-3-[[3-hydroxy-5-(sulfanylamino)pentyl]amino]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 145187882) has the molecular formula C18H19ClF3N3O2S and a molecular weight of 433.88 g/mol. Its IUPAC name is 4-chloro-3-[[3-hydroxy-5-(sulfanylamino)pentyl]amino]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[3-hydroxy-5-(sulfanylamino)pentyl]amino]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 145187882 |
| Molecular Formula | C18H19ClF3N3O2S |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 4-chloro-3-[[3-hydroxy-5-(sulfanylamino)pentyl]amino]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(NCCC(O)CCNS)c1 |
| InChI | InChI=1S/C18H19ClF3N3O2S/c19-13-2-1-10(7-16(13)23-5-3-12(26)4-6-24-28)18(27)25-11-8-14(20)17(22)15(21)9-11/h1-2,7-9,12,23-24,26,28H,3-6H2,(H,25,27) |
| InChIKey | GHQDUKLTKHDVRR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|