C7H9I2N — CID 130347858
(1E,3Z,5E)-2,5-diiodohepta-1,3,5-trien-1-amine (PubChem CID 130347858) has the molecular formula C7H9I2N and a molecular weight of 360.96 g/mol. Its IUPAC name is (1E,3Z,5E)-2,5-diiodohepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5E)-2,5-diiodohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 130347858 |
| Molecular Formula | C7H9I2N |
| Molecular Weight | 360.96 g/mol |
| Exact Mass | 360.88 |
| IUPAC Name | (1E,3Z,5E)-2,5-diiodohepta-1,3,5-trien-1-amine |
| SMILES | C/C=C(I)\C=C/C(I)=C\N |
| InChI | InChI=1S/C7H9I2N/c1-2-6(8)3-4-7(9)5-10/h2-5H,10H2,1H3/b4-3-,6-2+,7-5+ |
| InChIKey | ULMDYGQFGSDJOA-UWPVTECISA-N |
| XLogP | 3.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.96 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|