C18H25N5O2 — CID 130372045
2-(6-morpholin-4-yl-1,4-dihydropyrimidine-4-carboximidoyl)-4-propan-2-yloxyaniline (PubChem CID 130372045) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-(6-morpholin-4-yl-1,4-dihydropyrimidine-4-carboximidoyl)-4-propan-2-yloxyaniline.
| Compound Name | 2-(6-morpholin-4-yl-1,4-dihydropyrimidine-4-carboximidoyl)-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 130372045 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-(6-morpholin-4-yl-1,4-dihydropyrimidine-4-carboximidoyl)-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(/c1cc(OC(C)C)ccc1N)C1C=C(N2CCOCC2)NC=N1 |
| InChI | InChI=1S/C18H25N5O2/c1-12(2)25-13-3-4-15(19)14(9-13)18(20)16-10-17(22-11-21-16)23-5-7-24-8-6-23/h3-4,9-12,16,20H,5-8,19H2,1-2H3,(H,21,22)/b20-18- |
| InChIKey | SDXVFXXHJROJIB-ZZEZOPTASA-N |
| XLogP | 1.60 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|