C23H31FN6O3S — CID 130414057
2-[6-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,4-dihydropyrimidine-4-carboximidoyl]-5-fluoro-4-(1-methylcyclopropyl)oxyaniline (PubChem CID 130414057) has the molecular formula C23H31FN6O3S and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[6-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,4-dihydropyrimidine-4-carboximidoyl]-5-fluoro-4-(1-methylcyclopropyl)oxyaniline.
| Compound Name | 2-[6-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,4-dihydropyrimidine-4-carboximidoyl]-5-fluoro-4-(1-methylcyclopropyl)oxyaniline |
|---|---|
| PubChem CID | 130414057 |
| Molecular Formula | C23H31FN6O3S |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-[6-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]-1,4-dihydropyrimidine-4-carboximidoyl]-5-fluoro-4-(1-methylcyclopropyl)oxyaniline |
| SMILES | [H]/N=C(/c1cc(OC2(C)CC2)c(F)cc1N)C1C=C(N2CCN(C3CCS(=O)(=O)C3)CC2)NC=N1 |
| InChI | InChI=1S/C23H31FN6O3S/c1-23(3-4-23)33-20-10-16(18(25)11-17(20)24)22(26)19-12-21(28-14-27-19)30-7-5-29(6-8-30)15-2-9-34(31,32)13-15/h10-12,14-15,19,26H,2-9,13,25H2,1H3,(H,27,28)/b26-22- |
| InChIKey | JNHHCJFUYZWSPU-ROMGYVFFSA-N |
| XLogP | 1.35 |
| TPSA | 124.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|