C12H18OS — CID 130372645
(3E,4Z,6E)-6-methyl-3-propylidene-7-sulfanylocta-4,6-dien-2-one (PubChem CID 130372645) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is (3E,4Z,6E)-6-methyl-3-propylidene-7-sulfanylocta-4,6-dien-2-one.
| Compound Name | (3E,4Z,6E)-6-methyl-3-propylidene-7-sulfanylocta-4,6-dien-2-one |
|---|---|
| PubChem CID | 130372645 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (3E,4Z,6E)-6-methyl-3-propylidene-7-sulfanylocta-4,6-dien-2-one |
| SMILES | CC/C=C(\C=C/C(C)=C(\C)S)C(C)=O |
| InChI | InChI=1S/C12H18OS/c1-5-6-12(10(3)13)8-7-9(2)11(4)14/h6-8,14H,5H2,1-4H3/b8-7-,11-9+,12-6+ |
| InChIKey | PYTSOJLYDRZSRV-CRLUEARGSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|