C11H19N3O5S — CID 130394777
tert-butyl N-(2-methyl-1,1-dioxo-4a,5,6,7a-tetrahydrofuro[3,2-e][1,2,4]thiadiazin-3-yl)carbamate (PubChem CID 130394777) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-1,1-dioxo-4a,5,6,7a-tetrahydrofuro[3,2-e][1,2,4]thiadiazin-3-yl)carbamate.
| Compound Name | tert-butyl N-(2-methyl-1,1-dioxo-4a,5,6,7a-tetrahydrofuro[3,2-e][1,2,4]thiadiazin-3-yl)carbamate |
|---|---|
| PubChem CID | 130394777 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | tert-butyl N-(2-methyl-1,1-dioxo-4a,5,6,7a-tetrahydrofuro[3,2-e][1,2,4]thiadiazin-3-yl)carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=NC2CCOC2S1(=O)=O |
| InChI | InChI=1S/C11H19N3O5S/c1-11(2,3)19-10(15)13-9-12-7-5-6-18-8(7)20(16,17)14(9)4/h7-8H,5-6H2,1-4H3,(H,12,13,15) |
| InChIKey | YPMPCTBUVMCNPO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |