C15H24ClN3O5S2 — CID 123687647
tert-butyl N-[4a-(2-chloropropanethioyl)-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-3-yl]carbamate (PubChem CID 123687647) has the molecular formula C15H24ClN3O5S2 and a molecular weight of 425.96 g/mol. Its IUPAC name is tert-butyl N-[4a-(2-chloropropanethioyl)-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[4a-(2-chloropropanethioyl)-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 123687647 |
| Molecular Formula | C15H24ClN3O5S2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | tert-butyl N-[4a-(2-chloropropanethioyl)-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-3-yl]carbamate |
| SMILES | CC(Cl)C(=S)C12COCCC1S(=O)(=O)N(C)C(NC(=O)OC(C)(C)C)=N2 |
| InChI | InChI=1S/C15H24ClN3O5S2/c1-9(16)11(25)15-8-23-7-6-10(15)26(21,22)19(5)12(18-15)17-13(20)24-14(2,3)4/h9-10H,6-8H2,1-5H3,(H,17,18,20) |
| InChIKey | JDTGPDPHBQGQMT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|