C16H11F2N3O5 — CID 130405719
1-(2,6-difluorobenzoyl)-3-hydroxy-2-(3-nitrophenyl)imidazolidin-4-one (PubChem CID 130405719) has the molecular formula C16H11F2N3O5 and a molecular weight of 363.28 g/mol. Its IUPAC name is 1-(2,6-difluorobenzoyl)-3-hydroxy-2-(3-nitrophenyl)imidazolidin-4-one.
| Compound Name | 1-(2,6-difluorobenzoyl)-3-hydroxy-2-(3-nitrophenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 130405719 |
| Molecular Formula | C16H11F2N3O5 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 1-(2,6-difluorobenzoyl)-3-hydroxy-2-(3-nitrophenyl)imidazolidin-4-one |
| SMILES | O=C1CN(C(=O)c2c(F)cccc2F)C(c2cccc([N+](=O)[O-])c2)N1O |
| InChI | InChI=1S/C16H11F2N3O5/c17-11-5-2-6-12(18)14(11)16(23)19-8-13(22)20(24)15(19)9-3-1-4-10(7-9)21(25)26/h1-7,15,24H,8H2 |
| InChIKey | YRTNKWNEQWTVOF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|