C20H19ClN4O3S2 — CID 130420745
4-[[(4-chloro-1,5-dimethylindol-2-yl)-hydroxymethyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 130420745) has the molecular formula C20H19ClN4O3S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 4-[[(4-chloro-1,5-dimethylindol-2-yl)-hydroxymethyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(4-chloro-1,5-dimethylindol-2-yl)-hydroxymethyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 130420745 |
| Molecular Formula | C20H19ClN4O3S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 4-[[(4-chloro-1,5-dimethylindol-2-yl)-hydroxymethyl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc2c(cc(C(O)Nc3ccc(S(=O)(=O)Nc4nccs4)cc3)n2C)c1Cl |
| InChI | InChI=1S/C20H19ClN4O3S2/c1-12-3-8-16-15(18(12)21)11-17(25(16)2)19(26)23-13-4-6-14(7-5-13)30(27,28)24-20-22-9-10-29-20/h3-11,19,23,26H,1-2H3,(H,22,24) |
| InChIKey | LYLSIJOYQPRESM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|