About 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine
2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine (PubChem CID 130433744) has the molecular formula C11H15ClN2S
and a molecular weight of 242.78 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine |
| PubChem CID | 130433744 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.78 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine |
| SMILES | CNc1cc(Cl)ncc1C#CS(C)(C)C |
| InChI | InChI=1S/C11H15ClN2S/c1-13-10-7-11(12)14-8-9(10)5-6-15(2,3)4/h7-8H,1-4H3,(H,13,14) |
| InChIKey | XVUSKOUEJQFBBR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine?
The IUPAC name of 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine (CID 130433744) is 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine.
What is the SMILES notation for 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine?
The canonical SMILES for 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine is CNc1cc(Cl)ncc1C#CS(C)(C)C.
What is the InChIKey of 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine?
The InChIKey is XVUSKOUEJQFBBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2S/c1-13-10-7-11(12)14-8-9(10)5-6-15(2,3)4/h7-8H,1-4H3,(H,13,14).
What are the key properties of 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine?
2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine has a molecular weight of 242.78 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methyl-5-[2-(trimethyl-λ4-sulfanyl)ethynyl]pyridin-4-amine is sourced from PubChem (CID 130433744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).