C25H27F2N7O — CID 130437109
(4R)-7-[3-(3,3-difluoropyrrolidin-1-yl)phenyl]-1,4-dimethyl-N-pyrazin-2-yl-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 130437109) has the molecular formula C25H27F2N7O and a molecular weight of 479.54 g/mol. Its IUPAC name is (4R)-7-[3-(3,3-difluoropyrrolidin-1-yl)phenyl]-1,4-dimethyl-N-pyrazin-2-yl-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | (4R)-7-[3-(3,3-difluoropyrrolidin-1-yl)phenyl]-1,4-dimethyl-N-pyrazin-2-yl-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 130437109 |
| Molecular Formula | C25H27F2N7O |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (4R)-7-[3-(3,3-difluoropyrrolidin-1-yl)phenyl]-1,4-dimethyl-N-pyrazin-2-yl-3,4-dihydro-2H-pyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | C[C@@H]1CCN(C)c2ccc(-c3cccc(N4CCC(F)(F)C4)c3)nc2N1C(=O)Nc1cnccn1 |
| InChI | InChI=1S/C25H27F2N7O/c1-17-8-12-32(2)21-7-6-20(18-4-3-5-19(14-18)33-13-9-25(26,27)16-33)30-23(21)34(17)24(35)31-22-15-28-10-11-29-22/h3-7,10-11,14-15,17H,8-9,12-13,16H2,1-2H3,(H,29,31,35)/t17-/m1/s1 |
| InChIKey | MGQRNSGZYCXUAR-QGZVFWFLSA-N |
| XLogP | 4.65 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |