C24H28N3OPS — CID 130439059
1,3-diphenyl-2-[piperidin-1-yl(thiophen-2-yl)methyl]-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 130439059) has the molecular formula C24H28N3OPS and a molecular weight of 437.55 g/mol. Its IUPAC name is 1,3-diphenyl-2-[piperidin-1-yl(thiophen-2-yl)methyl]-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | 1,3-diphenyl-2-[piperidin-1-yl(thiophen-2-yl)methyl]-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 130439059 |
| Molecular Formula | C24H28N3OPS |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1,3-diphenyl-2-[piperidin-1-yl(thiophen-2-yl)methyl]-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | O=P1(C(c2cccs2)N2CCCCC2)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C24H28N3OPS/c28-29(24(23-15-10-20-30-23)25-16-8-3-9-17-25)26(21-11-4-1-5-12-21)18-19-27(29)22-13-6-2-7-14-22/h1-2,4-7,10-15,20,24H,3,8-9,16-19H2 |
| InChIKey | KTVYPKJWJFUVQF-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|