C28H31N3O5 — CID 130443911
N-[4-[6-methoxy-7-[(E)-3-morpholin-4-ylprop-1-enoxy]quinolin-4-yl]oxyphenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 130443911) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is N-[4-[6-methoxy-7-[(E)-3-morpholin-4-ylprop-1-enoxy]quinolin-4-yl]oxyphenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-[4-[6-methoxy-7-[(E)-3-morpholin-4-ylprop-1-enoxy]quinolin-4-yl]oxyphenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 130443911 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-[4-[6-methoxy-7-[(E)-3-morpholin-4-ylprop-1-enoxy]quinolin-4-yl]oxyphenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C)CC4)cc3)ccnc2cc1O/C=C/CN1CCOCC1 |
| InChI | InChI=1S/C28H31N3O5/c1-28(9-10-28)27(32)30-20-4-6-21(7-5-20)36-24-8-11-29-23-19-26(25(33-2)18-22(23)24)35-15-3-12-31-13-16-34-17-14-31/h3-8,11,15,18-19H,9-10,12-14,16-17H2,1-2H3,(H,30,32)/b15-3+ |
| InChIKey | POCWPCOHBXIASC-CRKCGEKBSA-N |
| XLogP | 5.00 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|