C15H24O2 — CID 130462295
2-butoxy-5-tert-butylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 130462295) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-butoxy-5-tert-butylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 2-butoxy-5-tert-butylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 130462295 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-butoxy-5-tert-butylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CCCCOC1=C(C=O)CC(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C15H24O2/c1-5-6-9-17-14-8-7-13(15(2,3)4)10-12(14)11-16/h7-8,11,13H,5-6,9-10H2,1-4H3 |
| InChIKey | IANIOTWKCSIJTR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|