C19H19ClN4O4 — CID 130472192
(4-methoxyphenyl)methyl N-[1-(5-chloro-2-methoxyphenyl)-5-methyltriazol-4-yl]carbamate (PubChem CID 130472192) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[1-(5-chloro-2-methoxyphenyl)-5-methyltriazol-4-yl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[1-(5-chloro-2-methoxyphenyl)-5-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 130472192 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[1-(5-chloro-2-methoxyphenyl)-5-methyltriazol-4-yl]carbamate |
| SMILES | COc1ccc(COC(=O)Nc2nnn(-c3cc(Cl)ccc3OC)c2C)cc1 |
| InChI | InChI=1S/C19H19ClN4O4/c1-12-18(21-19(25)28-11-13-4-7-15(26-2)8-5-13)22-23-24(12)16-10-14(20)6-9-17(16)27-3/h4-10H,11H2,1-3H3,(H,21,25) |
| InChIKey | YNKXSSYRFQDJOZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |