C9H10ClNS — CID 130506722
5-(5-chlorothiophen-2-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 130506722) has the molecular formula C9H10ClNS and a molecular weight of 199.71 g/mol. Its IUPAC name is 5-(5-chlorothiophen-2-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(5-chlorothiophen-2-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 130506722 |
| Molecular Formula | C9H10ClNS |
| Molecular Weight | 199.71 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 5-(5-chlorothiophen-2-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | Clc1ccc(C2=CCCNC2)s1 |
| InChI | InChI=1S/C9H10ClNS/c10-9-4-3-8(12-9)7-2-1-5-11-6-7/h2-4,11H,1,5-6H2 |
| InChIKey | UEBJDHZNRSUXQS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |