C8H11Cl2N5 — CID 130561089
6-(1-chloroethyl)-2-N-(2-chloroprop-2-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 130561089) has the molecular formula C8H11Cl2N5 and a molecular weight of 248.12 g/mol. Its IUPAC name is 6-(1-chloroethyl)-2-N-(2-chloroprop-2-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-chloroethyl)-2-N-(2-chloroprop-2-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130561089 |
| Molecular Formula | C8H11Cl2N5 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 6-(1-chloroethyl)-2-N-(2-chloroprop-2-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C=C(Cl)CNc1nc(N)nc(C(C)Cl)n1 |
| InChI | InChI=1S/C8H11Cl2N5/c1-4(9)3-12-8-14-6(5(2)10)13-7(11)15-8/h5H,1,3H2,2H3,(H3,11,12,13,14,15) |
| InChIKey | LBAKGFJJCDGDPS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|