C8H7ClN4S — CID 130603940
4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidin-5-amine (PubChem CID 130603940) has the molecular formula C8H7ClN4S and a molecular weight of 226.69 g/mol. Its IUPAC name is 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidin-5-amine.
| Compound Name | 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 130603940 |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 4-chloro-6-(1,3-thiazol-2-ylmethyl)pyrimidin-5-amine |
| SMILES | Nc1c(Cl)ncnc1Cc1nccs1 |
| InChI | InChI=1S/C8H7ClN4S/c9-8-7(10)5(12-4-13-8)3-6-11-1-2-14-6/h1-2,4H,3,10H2 |
| InChIKey | KMGMKPANDHHBMN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |