C6H12N4O2S — CID 130618938
N-[2-[2-(methylcarbamothioyl)hydrazinyl]-2-oxoethyl]acetamide (PubChem CID 130618938) has the molecular formula C6H12N4O2S and a molecular weight of 204.25 g/mol. Its IUPAC name is N-[2-[2-(methylcarbamothioyl)hydrazinyl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[2-(methylcarbamothioyl)hydrazinyl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 130618938 |
| Molecular Formula | C6H12N4O2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | N-[2-[2-(methylcarbamothioyl)hydrazinyl]-2-oxoethyl]acetamide |
| SMILES | CNC(=S)NNC(=O)CNC(C)=O |
| InChI | InChI=1S/C6H12N4O2S/c1-4(11)8-3-5(12)9-10-6(13)7-2/h3H2,1-2H3,(H,8,11)(H,9,12)(H2,7,10,13) |
| InChIKey | JNPDWLDPNCSTMX-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|