C6H6F3NOS — CID 130620035
4-[(1S)-1-amino-2,2,2-trifluoroethyl]thiophen-2-ol (PubChem CID 130620035) has the molecular formula C6H6F3NOS and a molecular weight of 197.18 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2,2-trifluoroethyl]thiophen-2-ol.
| Compound Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]thiophen-2-ol |
|---|---|
| PubChem CID | 130620035 |
| Molecular Formula | C6H6F3NOS |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]thiophen-2-ol |
| SMILES | N[C@@H](c1csc(O)c1)C(F)(F)F |
| InChI | InChI=1S/C6H6F3NOS/c7-6(8,9)5(10)3-1-4(11)12-2-3/h1-2,5,11H,10H2/t5-/m0/s1 |
| InChIKey | UHTKNGCWWIUJKC-YFKPBYRVSA-N |
| XLogP | 2.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |