C7H7Br2N3S — CID 130708546
1-(5,6-dibromo-3-pyridinyl)-3-methylthiourea (PubChem CID 130708546) has the molecular formula C7H7Br2N3S and a molecular weight of 325.03 g/mol. Its IUPAC name is 1-(5,6-dibromo-3-pyridinyl)-3-methylthiourea.
| Compound Name | 1-(5,6-dibromo-3-pyridinyl)-3-methylthiourea |
|---|---|
| PubChem CID | 130708546 |
| Molecular Formula | C7H7Br2N3S |
| Molecular Weight | 325.03 g/mol |
| Exact Mass | 322.87 |
| IUPAC Name | 1-(5,6-dibromo-3-pyridinyl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1cnc(Br)c(Br)c1 |
| InChI | InChI=1S/C7H7Br2N3S/c1-10-7(13)12-4-2-5(8)6(9)11-3-4/h2-3H,1H3,(H2,10,12,13) |
| InChIKey | MVLYLGRBLBNOGH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.03 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|