C8H12N4 — CID 130775606
1-cyclohex-3-en-1-yl-1,2,4-triazol-3-amine (PubChem CID 130775606) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-1,2,4-triazol-3-amine.
| Compound Name | 1-cyclohex-3-en-1-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 130775606 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(C2CC=CCC2)n1 |
| InChI | InChI=1S/C8H12N4/c9-8-10-6-12(11-8)7-4-2-1-3-5-7/h1-2,6-7H,3-5H2,(H2,9,11) |
| InChIKey | HJVFXQOWFMVBEX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|