C13H12ClNO5S — CID 13103778
[2-chloro-4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-6-methoxyphenyl] acetate (PubChem CID 13103778) has the molecular formula C13H12ClNO5S and a molecular weight of 329.76 g/mol. Its IUPAC name is [2-chloro-4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-6-methoxyphenyl] acetate.
| Compound Name | [2-chloro-4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 13103778 |
| Molecular Formula | C13H12ClNO5S |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | [2-chloro-4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-6-methoxyphenyl] acetate |
| SMILES | COc1cc(CC2SC(=O)NC2=O)cc(Cl)c1OC(C)=O |
| InChI | InChI=1S/C13H12ClNO5S/c1-6(16)20-11-8(14)3-7(4-9(11)19-2)5-10-12(17)15-13(18)21-10/h3-4,10H,5H2,1-2H3,(H,15,17,18) |
| InChIKey | ILVXZWYCUUODSP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|