C7H12N4OS — CID 131076104
(5-methyl-1,2,4-oxadiazol-3-yl)methyl N,N'-dimethylcarbamimidothioate (PubChem CID 131076104) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is (5-methyl-1,2,4-oxadiazol-3-yl)methyl N,N'-dimethylcarbamimidothioate.
| Compound Name | (5-methyl-1,2,4-oxadiazol-3-yl)methyl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 131076104 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (5-methyl-1,2,4-oxadiazol-3-yl)methyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCc1noc(C)n1 |
| InChI | InChI=1S/C7H12N4OS/c1-5-10-6(11-12-5)4-13-7(8-2)9-3/h4H2,1-3H3,(H,8,9) |
| InChIKey | KIMMZVUIMOHEFE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|