C10H11F2NO — CID 131122898
3-[(1R)-1-aminoprop-2-enyl]-2,5-difluoro-4-methylphenol (PubChem CID 131122898) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 3-[(1R)-1-aminoprop-2-enyl]-2,5-difluoro-4-methylphenol.
| Compound Name | 3-[(1R)-1-aminoprop-2-enyl]-2,5-difluoro-4-methylphenol |
|---|---|
| PubChem CID | 131122898 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-[(1R)-1-aminoprop-2-enyl]-2,5-difluoro-4-methylphenol |
| SMILES | C=C[C@@H](N)c1c(C)c(F)cc(O)c1F |
| InChI | InChI=1S/C10H11F2NO/c1-3-7(13)9-5(2)6(11)4-8(14)10(9)12/h3-4,7,14H,1,13H2,2H3/t7-/m1/s1 |
| InChIKey | UXCKRXNHARPEFO-SSDOTTSWSA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|