C6H14N2O2S — CID 131227779
1,3-dimethyl-1-(2-methylsulfinylethyl)urea (PubChem CID 131227779) has the molecular formula C6H14N2O2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 1,3-dimethyl-1-(2-methylsulfinylethyl)urea.
| Compound Name | 1,3-dimethyl-1-(2-methylsulfinylethyl)urea |
|---|---|
| PubChem CID | 131227779 |
| Molecular Formula | C6H14N2O2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1,3-dimethyl-1-(2-methylsulfinylethyl)urea |
| SMILES | CNC(=O)N(C)CCS(C)=O |
| InChI | InChI=1S/C6H14N2O2S/c1-7-6(9)8(2)4-5-11(3)10/h4-5H2,1-3H3,(H,7,9) |
| InChIKey | LGFALNUHBJPWBL-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |