C12H11ClN2O — CID 13158387
1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-1-ium-3-carboxamide chloride (PubChem CID 13158387) has the molecular formula C12H11ClN2O and a molecular weight of 239.72 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 13158387 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 239.72 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-1-ium-3-carboxamide chloride |
| SMILES | [2H]c1c([2H])c([2H])c(-[n+]2cccc(C(N)=O)c2)c([2H])c1[2H].[Cl-] |
| InChI | InChI=1S/C12H10N2O.ClH/c13-12(15)10-5-4-8-14(9-10)11-6-2-1-3-7-11;/h1-9H,(H-,13,15);1H/i1D,2D,3D,6D,7D; |
| InChIKey | JYPNAQSZDLVXES-ISWUXAKYSA-N |
| XLogP | -1.93 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.72 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|