C4H11Cl2N — CID 131698787
2-chloro-1,1,2,2-tetradeuterio-N-(dideuteriomethyl)-N-methylethanamine;hydrochloride (PubChem CID 131698787) has the molecular formula C4H11Cl2N and a molecular weight of 150.08 g/mol. Its IUPAC name is 2-chloro-1,1,2,2-tetradeuterio-N-(dideuteriomethyl)-N-methylethanamine;hydrochloride.
| Compound Name | 2-chloro-1,1,2,2-tetradeuterio-N-(dideuteriomethyl)-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 131698787 |
| Molecular Formula | C4H11Cl2N |
| Molecular Weight | 150.08 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 2-chloro-1,1,2,2-tetradeuterio-N-(dideuteriomethyl)-N-methylethanamine;hydrochloride |
| SMILES | Cl.[2H]C([2H])N(C)C([2H])([2H])C([2H])([2H])Cl |
| InChI | InChI=1S/C4H10ClN.ClH/c1-6(2)4-3-5;/h3-4H2,1-2H3;1H/i1D2,3D2,4D2; |
| InChIKey | LQLJZSJKRYTKTP-KCBZJTFISA-N |
| XLogP | 1.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.08 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|