C4H10ClN — CID 131698788
2-chloro-1,1,2,2-tetradeuterio-N-(dideuteriomethyl)-N-methylethanamine (PubChem CID 131698788) has the molecular formula C4H10ClN and a molecular weight of 113.62 g/mol. Its IUPAC name is 2-chloro-1,1,2,2-tetradeuterio-N-(dideuteriomethyl)-N-methylethanamine.
| Compound Name | 2-chloro-1,1,2,2-tetradeuterio-N-(dideuteriomethyl)-N-methylethanamine |
|---|---|
| PubChem CID | 131698788 |
| Molecular Formula | C4H10ClN |
| Molecular Weight | 113.62 g/mol |
| Exact Mass | 113.09 |
| IUPAC Name | 2-chloro-1,1,2,2-tetradeuterio-N-(dideuteriomethyl)-N-methylethanamine |
| SMILES | [2H]C([2H])N(C)C([2H])([2H])C([2H])([2H])Cl |
| InChI | InChI=1S/C4H10ClN/c1-6(2)4-3-5/h3-4H2,1-2H3/i1D2,3D2,4D2 |
| InChIKey | WQMAANNAZKNUDL-ORNWBJTKSA-N |
| XLogP | 0.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.62 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|