C28H33N3O4P+ — CID 131718867
dihydroxy(oxo)phosphanium;2-ethyl-2-methyl-1-(2-trityl-1,2,4-triazol-3-yl)butan-1-ol (PubChem CID 131718867) has the molecular formula C28H33N3O4P+ and a molecular weight of 506.56 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2-ethyl-2-methyl-1-(2-trityl-1,2,4-triazol-3-yl)butan-1-ol.
| Compound Name | dihydroxy(oxo)phosphanium;2-ethyl-2-methyl-1-(2-trityl-1,2,4-triazol-3-yl)butan-1-ol |
|---|---|
| PubChem CID | 131718867 |
| Molecular Formula | C28H33N3O4P+ |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2-ethyl-2-methyl-1-(2-trityl-1,2,4-triazol-3-yl)butan-1-ol |
| SMILES | CCC(C)(CC)C(O)c1ncnn1C(c1ccccc1)(c1ccccc1)c1ccccc1.O=[P+](O)O |
| InChI | InChI=1S/C28H31N3O.HO3P/c1-4-27(3,5-2)25(32)26-29-21-30-31(26)28(22-15-9-6-10-16-22,23-17-11-7-12-18-23)24-19-13-8-14-20-24;1-4(2)3/h6-21,25,32H,4-5H2,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | REFMOFNBNQWJHZ-UHFFFAOYSA-O |
| XLogP | 5.61 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|