C29H33N3O — CID 131718915
3-(2-ethyl-1-methoxy-2-methylbutyl)-1-trityl-1,2,4-triazole (PubChem CID 131718915) has the molecular formula C29H33N3O and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-(2-ethyl-1-methoxy-2-methylbutyl)-1-trityl-1,2,4-triazole.
| Compound Name | 3-(2-ethyl-1-methoxy-2-methylbutyl)-1-trityl-1,2,4-triazole |
|---|---|
| PubChem CID | 131718915 |
| Molecular Formula | C29H33N3O |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 3-(2-ethyl-1-methoxy-2-methylbutyl)-1-trityl-1,2,4-triazole |
| SMILES | CCC(C)(CC)C(OC)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H33N3O/c1-5-28(3,6-2)26(33-4)27-30-22-32(31-27)29(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-22,26H,5-6H2,1-4H3 |
| InChIKey | PUUTXRVCOABQMK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|