C28H32IN3O3P+ — CID 131718879
dihydroxy(oxo)phosphanium;3-(2-ethyl-1-iodo-2-methylbutyl)-1-trityl-1,2,4-triazole (PubChem CID 131718879) has the molecular formula C28H32IN3O3P+ and a molecular weight of 616.46 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;3-(2-ethyl-1-iodo-2-methylbutyl)-1-trityl-1,2,4-triazole.
| Compound Name | dihydroxy(oxo)phosphanium;3-(2-ethyl-1-iodo-2-methylbutyl)-1-trityl-1,2,4-triazole |
|---|---|
| PubChem CID | 131718879 |
| Molecular Formula | C28H32IN3O3P+ |
| Molecular Weight | 616.46 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | dihydroxy(oxo)phosphanium;3-(2-ethyl-1-iodo-2-methylbutyl)-1-trityl-1,2,4-triazole |
| SMILES | CCC(C)(CC)C(I)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1.O=[P+](O)O |
| InChI | InChI=1S/C28H30IN3.HO3P/c1-4-27(3,5-2)25(29)26-30-21-32(31-26)28(22-15-9-6-10-16-22,23-17-11-7-12-18-23)24-19-13-8-14-20-24;1-4(2)3/h6-21,25H,4-5H2,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | NTNQYQVUSYGCQW-UHFFFAOYSA-O |
| XLogP | 7.05 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.46 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|