C28H30IN3 — CID 67570872
3-(3-ethyl-1-iodopentyl)-1-trityl-1,2,4-triazole (PubChem CID 67570872) has the molecular formula C28H30IN3 and a molecular weight of 535.47 g/mol. Its IUPAC name is 3-(3-ethyl-1-iodopentyl)-1-trityl-1,2,4-triazole.
| Compound Name | 3-(3-ethyl-1-iodopentyl)-1-trityl-1,2,4-triazole |
|---|---|
| PubChem CID | 67570872 |
| Molecular Formula | C28H30IN3 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 3-(3-ethyl-1-iodopentyl)-1-trityl-1,2,4-triazole |
| SMILES | CCC(CC)CC(I)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H30IN3/c1-3-22(4-2)20-26(29)27-30-21-32(31-27)28(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,21-22,26H,3-4,20H2,1-2H3 |
| InChIKey | KPQYCIWJOPBSAE-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|