C30H35N3O5P+ — CID 131718869
dihydroxy(oxo)phosphanium;[2-ethyl-2-methyl-1-(1-trityl-1,2,4-triazol-3-yl)butyl] acetate (PubChem CID 131718869) has the molecular formula C30H35N3O5P+ and a molecular weight of 548.60 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;[2-ethyl-2-methyl-1-(1-trityl-1,2,4-triazol-3-yl)butyl] acetate.
| Compound Name | dihydroxy(oxo)phosphanium;[2-ethyl-2-methyl-1-(1-trityl-1,2,4-triazol-3-yl)butyl] acetate |
|---|---|
| PubChem CID | 131718869 |
| Molecular Formula | C30H35N3O5P+ |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | dihydroxy(oxo)phosphanium;[2-ethyl-2-methyl-1-(1-trityl-1,2,4-triazol-3-yl)butyl] acetate |
| SMILES | CCC(C)(CC)C(OC(C)=O)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1.O=[P+](O)O |
| InChI | InChI=1S/C30H33N3O2.HO3P/c1-5-29(4,6-2)27(35-23(3)34)28-31-22-33(32-28)30(24-16-10-7-11-17-24,25-18-12-8-13-19-25)26-20-14-9-15-21-26;1-4(2)3/h7-22,27H,5-6H2,1-4H3;(H-,1,2,3)/p+1 |
| InChIKey | PSJRLVSQZPQCPE-UHFFFAOYSA-O |
| XLogP | 6.18 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|