C30H34N3O5P — CID 57128207
[3-[ethoxy(ethyl)phosphoryl]oxy-1-(1-trityl-1,2,4-triazol-3-yl)propyl] acetate (PubChem CID 57128207) has the molecular formula C30H34N3O5P and a molecular weight of 547.59 g/mol. Its IUPAC name is [3-[ethoxy(ethyl)phosphoryl]oxy-1-(1-trityl-1,2,4-triazol-3-yl)propyl] acetate.
| Compound Name | [3-[ethoxy(ethyl)phosphoryl]oxy-1-(1-trityl-1,2,4-triazol-3-yl)propyl] acetate |
|---|---|
| PubChem CID | 57128207 |
| Molecular Formula | C30H34N3O5P |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | [3-[ethoxy(ethyl)phosphoryl]oxy-1-(1-trityl-1,2,4-triazol-3-yl)propyl] acetate |
| SMILES | CCOP(=O)(CC)OCCC(OC(C)=O)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C30H34N3O5P/c1-4-36-39(35,5-2)37-22-21-28(38-24(3)34)29-31-23-33(32-29)30(25-15-9-6-10-16-25,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,23,28H,4-5,21-22H2,1-3H3 |
| InChIKey | NAMPKDDYAZPEIO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|