About dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one
dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one (PubChem CID 67873025) has the molecular formula C24H23N3O4P+
and a molecular weight of 448.44 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one |
| PubChem CID | 67873025 |
| Molecular Formula | C24H23N3O4P+ |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one |
| SMILES | CCC(=O)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1.O=[P+](O)O |
| InChI | InChI=1S/C24H21N3O.HO3P/c1-2-22(28)23-25-18-27(26-23)24(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-4(2)3/h3-18H,2H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | QHJRNCCOYAJJJL-UHFFFAOYSA-O |
| XLogP | 4.34 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one?
The IUPAC name of dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one (CID 67873025) is dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one.
What is the SMILES notation for dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one?
The canonical SMILES for dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one is CCC(=O)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one?
The InChIKey is QHJRNCCOYAJJJL-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H21N3O.HO3P/c1-2-22(28)23-25-18-27(26-23)24(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-4(2)3/h3-18H,2H2,1H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one?
dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one has a molecular weight of 448.44 g/mol, XLogP of 4.34, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-one is sourced from PubChem (CID 67873025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).