C20H28FN3O5S — CID 131735335
tert-butyl N-[(11bR)-10-amino-4a-fluoro-3,3,11b-trimethyl-4,4-dioxo-5,6-dihydro-[1]benzoxepino[4,5-b][1,4]thiazin-2-yl]carbamate (PubChem CID 131735335) has the molecular formula C20H28FN3O5S and a molecular weight of 441.53 g/mol. Its IUPAC name is tert-butyl N-[(11bR)-10-amino-4a-fluoro-3,3,11b-trimethyl-4,4-dioxo-5,6-dihydro-[1]benzoxepino[4,5-b][1,4]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(11bR)-10-amino-4a-fluoro-3,3,11b-trimethyl-4,4-dioxo-5,6-dihydro-[1]benzoxepino[4,5-b][1,4]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 131735335 |
| Molecular Formula | C20H28FN3O5S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | tert-butyl N-[(11bR)-10-amino-4a-fluoro-3,3,11b-trimethyl-4,4-dioxo-5,6-dihydro-[1]benzoxepino[4,5-b][1,4]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@]2(C)c3cc(N)ccc3OCCC2(F)S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C20H28FN3O5S/c1-17(2,3)29-16(25)23-15-18(4,5)30(26,27)20(21)9-10-28-14-8-7-12(22)11-13(14)19(20,6)24-15/h7-8,11H,9-10,22H2,1-6H3,(H,23,24,25)/t19-,20?/m1/s1 |
| InChIKey | PVEHLUQBPVEIAR-FIWHBWSRSA-N |
| XLogP | 3.06 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|