C19H27FN2O8S — CID 131739117
tert-butyl N-[(3R,4S,5S)-5-[[3-fluoro-5-(methoxymethyl)-4-nitrophenyl]methyl]-4-hydroxy-1,1-dioxothian-3-yl]carbamate (PubChem CID 131739117) has the molecular formula C19H27FN2O8S and a molecular weight of 462.50 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S,5S)-5-[[3-fluoro-5-(methoxymethyl)-4-nitrophenyl]methyl]-4-hydroxy-1,1-dioxothian-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S,5S)-5-[[3-fluoro-5-(methoxymethyl)-4-nitrophenyl]methyl]-4-hydroxy-1,1-dioxothian-3-yl]carbamate |
|---|---|
| PubChem CID | 131739117 |
| Molecular Formula | C19H27FN2O8S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | tert-butyl N-[(3R,4S,5S)-5-[[3-fluoro-5-(methoxymethyl)-4-nitrophenyl]methyl]-4-hydroxy-1,1-dioxothian-3-yl]carbamate |
| SMILES | COCc1cc(C[C@@H]2CS(=O)(=O)C[C@H](NC(=O)OC(C)(C)C)[C@H]2O)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H27FN2O8S/c1-19(2,3)30-18(24)21-15-10-31(27,28)9-13(17(15)23)6-11-5-12(8-29-4)16(22(25)26)14(20)7-11/h5,7,13,15,17,23H,6,8-10H2,1-4H3,(H,21,24)/t13-,15+,17+/m1/s1 |
| InChIKey | QDCHPQGIXWEQSU-KMFMINBZSA-N |
| XLogP | 1.72 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|